About 3-aminopropylsilyl triethyl silicate
3-aminopropylsilyl triethyl silicate (PubChem CID 123662062) has the molecular formula C9H25NO4Si2
and a molecular weight of 267.47 g/mol. Its IUPAC name is 3-aminopropylsilyl triethyl silicate.
Molecular Properties
| Compound Name | 3-aminopropylsilyl triethyl silicate |
| PubChem CID | 123662062 |
| Molecular Formula | C9H25NO4Si2 |
| Molecular Weight | 267.47 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-aminopropylsilyl triethyl silicate |
| SMILES | CCO[Si](OCC)(OCC)O[SiH2]CCCN |
| InChI | InChI=1S/C9H25NO4Si2/c1-4-11-16(12-5-2,13-6-3)14-15-9-7-8-10/h4-10,15H2,1-3H3 |
| InChIKey | AEZBKHLGXHGVRD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropylsilyl triethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropylsilyl triethyl silicate?
The IUPAC name of 3-aminopropylsilyl triethyl silicate (CID 123662062) is 3-aminopropylsilyl triethyl silicate.
What is the SMILES notation for 3-aminopropylsilyl triethyl silicate?
The canonical SMILES for 3-aminopropylsilyl triethyl silicate is CCO[Si](OCC)(OCC)O[SiH2]CCCN.
What is the InChIKey of 3-aminopropylsilyl triethyl silicate?
The InChIKey is AEZBKHLGXHGVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H25NO4Si2/c1-4-11-16(12-5-2,13-6-3)14-15-9-7-8-10/h4-10,15H2,1-3H3.
What are the key properties of 3-aminopropylsilyl triethyl silicate?
3-aminopropylsilyl triethyl silicate has a molecular weight of 267.47 g/mol, XLogP of 0.40, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropylsilyl triethyl silicate is sourced from PubChem (CID 123662062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).