C27H74N8O2Si4 — CID 158493369
3-[tris(diethylamino)silyloxysilyl]propan-1-amine;3-tris[ethyl(methyl)amino]silyloxysilylpropan-1-amine (PubChem CID 158493369) has the molecular formula C27H74N8O2Si4 and a molecular weight of 655.29 g/mol. Its IUPAC name is 3-[tris(diethylamino)silyloxysilyl]propan-1-amine;3-tris[ethyl(methyl)amino]silyloxysilylpropan-1-amine.
| Compound Name | 3-[tris(diethylamino)silyloxysilyl]propan-1-amine;3-tris[ethyl(methyl)amino]silyloxysilylpropan-1-amine |
|---|---|
| PubChem CID | 158493369 |
| Molecular Formula | C27H74N8O2Si4 |
| Molecular Weight | 655.29 g/mol |
| Exact Mass | 654.50 |
| IUPAC Name | 3-[tris(diethylamino)silyloxysilyl]propan-1-amine;3-tris[ethyl(methyl)amino]silyloxysilylpropan-1-amine |
| SMILES | CCN(C)[Si](O[SiH2]CCCN)(N(C)CC)N(C)CC.CCN(CC)[Si](O[SiH2]CCCN)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C15H40N4OSi2.C12H34N4OSi2/c1-7-17(8-2)22(18(9-3)10-4,19(11-5)12-6)20-21-15-13-14-16;1-7-14(4)19(15(5)8-2,16(6)9-3)17-18-12-10-11-13/h7-16,21H2,1-6H3;7-13,18H2,1-6H3 |
| InChIKey | HIYYVKCAWAJNIJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|