About benzyl acetate;N-ethenylpropan-1-amine
benzyl acetate;N-ethenylpropan-1-amine (PubChem CID 161342303) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is benzyl acetate;N-ethenylpropan-1-amine.
Molecular Properties
| Compound Name | benzyl acetate;N-ethenylpropan-1-amine |
| PubChem CID | 161342303 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | benzyl acetate;N-ethenylpropan-1-amine |
| SMILES | C=CNCCC.CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C9H10O2.C5H11N/c1-8(10)11-7-9-5-3-2-4-6-9;1-3-5-6-4-2/h2-6H,7H2,1H3;4,6H,2-3,5H2,1H3 |
| InChIKey | VMVHTBOQEIGCKI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl acetate;N-ethenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl acetate;N-ethenylpropan-1-amine?
The IUPAC name of benzyl acetate;N-ethenylpropan-1-amine (CID 161342303) is benzyl acetate;N-ethenylpropan-1-amine.
What is the SMILES notation for benzyl acetate;N-ethenylpropan-1-amine?
The canonical SMILES for benzyl acetate;N-ethenylpropan-1-amine is C=CNCCC.CC(=O)OCc1ccccc1.
What is the InChIKey of benzyl acetate;N-ethenylpropan-1-amine?
The InChIKey is VMVHTBOQEIGCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C5H11N/c1-8(10)11-7-9-5-3-2-4-6-9;1-3-5-6-4-2/h2-6H,7H2,1H3;4,6H,2-3,5H2,1H3.
What are the key properties of benzyl acetate;N-ethenylpropan-1-amine?
benzyl acetate;N-ethenylpropan-1-amine has a molecular weight of 235.33 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl acetate;N-ethenylpropan-1-amine is sourced from PubChem (CID 161342303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).