C28H49NO3 — CID 151377816
4-benzyl-N-ethenyl-4-(triethoxymethyl)dodecan-1-amine (PubChem CID 151377816) has the molecular formula C28H49NO3 and a molecular weight of 447.70 g/mol. Its IUPAC name is 4-benzyl-N-ethenyl-4-(triethoxymethyl)dodecan-1-amine.
| Compound Name | 4-benzyl-N-ethenyl-4-(triethoxymethyl)dodecan-1-amine |
|---|---|
| PubChem CID | 151377816 |
| Molecular Formula | C28H49NO3 |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 447.37 |
| IUPAC Name | 4-benzyl-N-ethenyl-4-(triethoxymethyl)dodecan-1-amine |
| SMILES | C=CNCCCC(CCCCCCCC)(Cc1ccccc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C28H49NO3/c1-6-11-12-13-14-18-22-27(23-19-24-29-7-2,25-26-20-16-15-17-21-26)28(30-8-3,31-9-4)32-10-5/h7,15-17,20-21,29H,2,6,8-14,18-19,22-25H2,1,3-5H3 |
| InChIKey | ORTVTTUDKGRVJA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|