C21H31F5O — CID 150326178
[2-(2-ethoxypropan-2-yl)-2,3,3,4,4-pentafluorodecyl]benzene (PubChem CID 150326178) has the molecular formula C21H31F5O and a molecular weight of 394.47 g/mol. Its IUPAC name is [2-(2-ethoxypropan-2-yl)-2,3,3,4,4-pentafluorodecyl]benzene.
| Compound Name | [2-(2-ethoxypropan-2-yl)-2,3,3,4,4-pentafluorodecyl]benzene |
|---|---|
| PubChem CID | 150326178 |
| Molecular Formula | C21H31F5O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [2-(2-ethoxypropan-2-yl)-2,3,3,4,4-pentafluorodecyl]benzene |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(Cc1ccccc1)C(C)(C)OCC |
| InChI | InChI=1S/C21H31F5O/c1-5-7-8-12-15-20(23,24)21(25,26)19(22,18(3,4)27-6-2)16-17-13-10-9-11-14-17/h9-11,13-14H,5-8,12,15-16H2,1-4H3 |
| InChIKey | GORPIGKUPNMBNC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|