C22H27F6N — CID 87882927
1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-methylnonan-1-amine (PubChem CID 87882927) has the molecular formula C22H27F6N and a molecular weight of 419.45 g/mol. Its IUPAC name is 1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-methylnonan-1-amine.
| Compound Name | 1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-methylnonan-1-amine |
|---|---|
| PubChem CID | 87882927 |
| Molecular Formula | C22H27F6N |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-methylnonan-1-amine |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H17F6N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-4-5-6-7-8(11,12)9(13,14)10(15,16)17-2/h1-10H;17H,3-7H2,1-2H3 |
| InChIKey | XUVYYRUXMPYTIC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|