C22H33F5O3 — CID 150999704
2,3,3,4,4-pentafluoro-2-phenyl-1,1-di(propan-2-yloxy)decan-1-ol (PubChem CID 150999704) has the molecular formula C22H33F5O3 and a molecular weight of 440.49 g/mol. Its IUPAC name is 2,3,3,4,4-pentafluoro-2-phenyl-1,1-di(propan-2-yloxy)decan-1-ol.
| Compound Name | 2,3,3,4,4-pentafluoro-2-phenyl-1,1-di(propan-2-yloxy)decan-1-ol |
|---|---|
| PubChem CID | 150999704 |
| Molecular Formula | C22H33F5O3 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2,3,3,4,4-pentafluoro-2-phenyl-1,1-di(propan-2-yloxy)decan-1-ol |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(c1ccccc1)C(O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C22H33F5O3/c1-6-7-8-12-15-19(23,24)21(26,27)20(25,18-13-10-9-11-14-18)22(28,29-16(2)3)30-17(4)5/h9-11,13-14,16-17,28H,6-8,12,15H2,1-5H3 |
| InChIKey | LTVQQJTYGYBTPS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|