C21H31F5O3 — CID 151349561
[1-(diethoxymethoxy)-1,2,2,3,3-pentafluorodecyl]benzene (PubChem CID 151349561) has the molecular formula C21H31F5O3 and a molecular weight of 426.47 g/mol. Its IUPAC name is [1-(diethoxymethoxy)-1,2,2,3,3-pentafluorodecyl]benzene.
| Compound Name | [1-(diethoxymethoxy)-1,2,2,3,3-pentafluorodecyl]benzene |
|---|---|
| PubChem CID | 151349561 |
| Molecular Formula | C21H31F5O3 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [1-(diethoxymethoxy)-1,2,2,3,3-pentafluorodecyl]benzene |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(OC(OCC)OCC)c1ccccc1 |
| InChI | InChI=1S/C21H31F5O3/c1-4-7-8-9-13-16-19(22,23)21(25,26)20(24,17-14-11-10-12-15-17)29-18(27-5-2)28-6-3/h10-12,14-15,18H,4-9,13,16H2,1-3H3 |
| InChIKey | OMEQPCRTNPOOEB-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|