C23H24F11N — CID 87883005
1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-(1,1,2,2,2-pentafluoroethyl)nonan-1-amine (PubChem CID 87883005) has the molecular formula C23H24F11N and a molecular weight of 523.43 g/mol. Its IUPAC name is 1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-(1,1,2,2,2-pentafluoroethyl)nonan-1-amine.
| Compound Name | 1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-(1,1,2,2,2-pentafluoroethyl)nonan-1-amine |
|---|---|
| PubChem CID | 87883005 |
| Molecular Formula | C23H24F11N |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 1,1'-biphenyl;1,1,2,2,3,3-hexafluoro-N-(1,1,2,2,2-pentafluoroethyl)nonan-1-amine |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NC(F)(F)C(F)(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H14F11N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-5-6-7(12,13)8(14,15)10(19,20)23-11(21,22)9(16,17)18/h1-10H;23H,2-6H2,1H3 |
| InChIKey | NKXRRVIUSWVHED-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|