C16H21F5O3 — CID 151575532
2,3,3,4,4-pentafluoro-2-phenyldecane-1,1,1-triol (PubChem CID 151575532) has the molecular formula C16H21F5O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2,3,3,4,4-pentafluoro-2-phenyldecane-1,1,1-triol.
| Compound Name | 2,3,3,4,4-pentafluoro-2-phenyldecane-1,1,1-triol |
|---|---|
| PubChem CID | 151575532 |
| Molecular Formula | C16H21F5O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2,3,3,4,4-pentafluoro-2-phenyldecane-1,1,1-triol |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(c1ccccc1)C(O)(O)O |
| InChI | InChI=1S/C16H21F5O3/c1-2-3-4-8-11-13(17,18)15(20,21)14(19,16(22,23)24)12-9-6-5-7-10-12/h5-7,9-10,22-24H,2-4,8,11H2,1H3 |
| InChIKey | QFJJAMBBKQBPRE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|