C18H31NO3Si — CID 54124529
N-[(3-ethenylphenyl)methyl]-3-triethoxysilylpropan-1-amine (PubChem CID 54124529) has the molecular formula C18H31NO3Si and a molecular weight of 337.54 g/mol. Its IUPAC name is N-[(3-ethenylphenyl)methyl]-3-triethoxysilylpropan-1-amine.
| Compound Name | N-[(3-ethenylphenyl)methyl]-3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 54124529 |
| Molecular Formula | C18H31NO3Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | N-[(3-ethenylphenyl)methyl]-3-triethoxysilylpropan-1-amine |
| SMILES | C=Cc1cccc(CNCCC[Si](OCC)(OCC)OCC)c1 |
| InChI | InChI=1S/C18H31NO3Si/c1-5-17-11-9-12-18(15-17)16-19-13-10-14-23(20-6-2,21-7-3)22-8-4/h5,9,11-12,15,19H,1,6-8,10,13-14,16H2,2-4H3 |
| InChIKey | NQAKNKPETVCPQR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|