C17H28O3Si — CID 139617910
3-[(3-ethenylphenyl)methoxy]propyl-diethoxy-methylsilane (PubChem CID 139617910) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is 3-[(3-ethenylphenyl)methoxy]propyl-diethoxy-methylsilane.
| Compound Name | 3-[(3-ethenylphenyl)methoxy]propyl-diethoxy-methylsilane |
|---|---|
| PubChem CID | 139617910 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-[(3-ethenylphenyl)methoxy]propyl-diethoxy-methylsilane |
| SMILES | C=Cc1cccc(COCCC[Si](C)(OCC)OCC)c1 |
| InChI | InChI=1S/C17H28O3Si/c1-5-16-10-8-11-17(14-16)15-18-12-9-13-21(4,19-6-2)20-7-3/h5,8,10-11,14H,1,6-7,9,12-13,15H2,2-4H3 |
| InChIKey | LSFISTYCWYTXEN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|