About 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene
1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene (PubChem CID 86122980) has the molecular formula C11H11F3O
and a molecular weight of 216.20 g/mol. Its IUPAC name is 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene |
| PubChem CID | 86122980 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene |
| SMILES | C=Cc1cccc(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3O/c1-2-9-4-3-5-10(6-9)7-15-8-11(12,13)14/h2-6H,1,7-8H2 |
| InChIKey | XBTOQUODZUJVKM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene?
The IUPAC name of 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene (CID 86122980) is 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene.
What is the SMILES notation for 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene?
The canonical SMILES for 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene is C=Cc1cccc(COCC(F)(F)F)c1.
What is the InChIKey of 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene?
The InChIKey is XBTOQUODZUJVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O/c1-2-9-4-3-5-10(6-9)7-15-8-11(12,13)14/h2-6H,1,7-8H2.
What are the key properties of 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene?
1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene has a molecular weight of 216.20 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-(2,2,2-trifluoroethoxymethyl)benzene is sourced from PubChem (CID 86122980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).