C16H12ClF3O — CID 155146173
2-chloro-1-[(3-ethenylphenyl)methoxy]-4-(trifluoromethyl)benzene (PubChem CID 155146173) has the molecular formula C16H12ClF3O and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-chloro-1-[(3-ethenylphenyl)methoxy]-4-(trifluoromethyl)benzene.
| Compound Name | 2-chloro-1-[(3-ethenylphenyl)methoxy]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 155146173 |
| Molecular Formula | C16H12ClF3O |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-chloro-1-[(3-ethenylphenyl)methoxy]-4-(trifluoromethyl)benzene |
| SMILES | C=Cc1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C16H12ClF3O/c1-2-11-4-3-5-12(8-11)10-21-15-7-6-13(9-14(15)17)16(18,19)20/h2-9H,1,10H2 |
| InChIKey | RLGYXLOTBFPAIO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |