C28H19BrCl2F6N2O6 — CID 162208329
1-(bromomethyl)-3-nitrobenzene;2-chloro-1-[(3-nitrophenyl)methoxy]-4-(trifluoromethyl)benzene;2-chloro-4-(trifluoromethyl)phenol (PubChem CID 162208329) has the molecular formula C28H19BrCl2F6N2O6 and a molecular weight of 744.27 g/mol. Its IUPAC name is 1-(bromomethyl)-3-nitrobenzene;2-chloro-1-[(3-nitrophenyl)methoxy]-4-(trifluoromethyl)benzene;2-chloro-4-(trifluoromethyl)phenol.
| Compound Name | 1-(bromomethyl)-3-nitrobenzene;2-chloro-1-[(3-nitrophenyl)methoxy]-4-(trifluoromethyl)benzene;2-chloro-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 162208329 |
| Molecular Formula | C28H19BrCl2F6N2O6 |
| Molecular Weight | 744.27 g/mol |
| Exact Mass | 741.97 |
| IUPAC Name | 1-(bromomethyl)-3-nitrobenzene;2-chloro-1-[(3-nitrophenyl)methoxy]-4-(trifluoromethyl)benzene;2-chloro-4-(trifluoromethyl)phenol |
| SMILES | O=[N+]([O-])c1cccc(CBr)c1.O=[N+]([O-])c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1.Oc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H9ClF3NO3.C7H6BrNO2.C7H4ClF3O/c15-12-7-10(14(16,17)18)4-5-13(12)22-8-9-2-1-3-11(6-9)19(20)21;8-5-6-2-1-3-7(4-6)9(10)11;8-5-3-4(7(9,10)11)1-2-6(5)12/h1-7H,8H2;1-4H,5H2;1-3,12H |
| InChIKey | ZSMPTIGUWYKDFF-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.27 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|