C26H19Br3Cl4O2 — CID 167660062
1-bromo-3-(bromomethyl)benzene;1-[(3-bromophenyl)methoxy]-2,4-dichlorobenzene;2,4-dichlorophenol (PubChem CID 167660062) has the molecular formula C26H19Br3Cl4O2 and a molecular weight of 744.96 g/mol. Its IUPAC name is 1-bromo-3-(bromomethyl)benzene;1-[(3-bromophenyl)methoxy]-2,4-dichlorobenzene;2,4-dichlorophenol.
| Compound Name | 1-bromo-3-(bromomethyl)benzene;1-[(3-bromophenyl)methoxy]-2,4-dichlorobenzene;2,4-dichlorophenol |
|---|---|
| PubChem CID | 167660062 |
| Molecular Formula | C26H19Br3Cl4O2 |
| Molecular Weight | 744.96 g/mol |
| Exact Mass | 739.77 |
| IUPAC Name | 1-bromo-3-(bromomethyl)benzene;1-[(3-bromophenyl)methoxy]-2,4-dichlorobenzene;2,4-dichlorophenol |
| SMILES | BrCc1cccc(Br)c1.Clc1ccc(OCc2cccc(Br)c2)c(Cl)c1.Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9BrCl2O.C7H6Br2.C6H4Cl2O/c14-10-3-1-2-9(6-10)8-17-13-5-4-11(15)7-12(13)16;8-5-6-2-1-3-7(9)4-6;7-4-1-2-6(9)5(8)3-4/h1-7H,8H2;1-4H,5H2;1-3,9H |
| InChIKey | RUZIZTYZYMGNOH-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.96 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|