C17H13F13O — CID 100997120
1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)benzene (PubChem CID 100997120) has the molecular formula C17H13F13O and a molecular weight of 480.26 g/mol. Its IUPAC name is 1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)benzene.
| Compound Name | 1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)benzene |
|---|---|
| PubChem CID | 100997120 |
| Molecular Formula | C17H13F13O |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)benzene |
| SMILES | C=Cc1cccc(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F13O/c1-2-10-4-3-5-11(8-10)9-31-7-6-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h2-5,8H,1,6-7,9H2 |
| InChIKey | QZRZXZOOIOTRNP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|