C14H11F9 — CID 155899402
1-ethenyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzene (PubChem CID 155899402) has the molecular formula C14H11F9 and a molecular weight of 350.22 g/mol. Its IUPAC name is 1-ethenyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzene.
| Compound Name | 1-ethenyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzene |
|---|---|
| PubChem CID | 155899402 |
| Molecular Formula | C14H11F9 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1-ethenyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzene |
| SMILES | C=Cc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F9/c1-2-9-3-5-10(6-4-9)7-8-11(15,16)12(17,18)13(19,20)14(21,22)23/h2-6H,1,7-8H2 |
| InChIKey | OBZAGLXUBQUHLF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|