C18H23F3O2 — CID 20710305
tert-butyl 4-(4-ethenylphenyl)-2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 20710305) has the molecular formula C18H23F3O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is tert-butyl 4-(4-ethenylphenyl)-2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | tert-butyl 4-(4-ethenylphenyl)-2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 20710305 |
| Molecular Formula | C18H23F3O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | tert-butyl 4-(4-ethenylphenyl)-2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | C=Cc1ccc(CCC(C)(C(=O)OC(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3O2/c1-6-13-7-9-14(10-8-13)11-12-17(5,18(19,20)21)15(22)23-16(2,3)4/h6-10H,1,11-12H2,2-5H3 |
| InChIKey | CKXAJQREKUKICS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |