C18H9F19 — CID 134294875
1-ethenyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl)benzene (PubChem CID 134294875) has the molecular formula C18H9F19 and a molecular weight of 586.23 g/mol. Its IUPAC name is 1-ethenyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl)benzene.
| Compound Name | 1-ethenyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl)benzene |
|---|---|
| PubChem CID | 134294875 |
| Molecular Formula | C18H9F19 |
| Molecular Weight | 586.23 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | 1-ethenyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl)benzene |
| SMILES | C=Cc1ccc(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H9F19/c1-2-8-3-5-9(6-4-8)7-10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)18(35,36)37/h2-6H,1,7H2 |
| InChIKey | FMZAGCPKCSXJKX-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.23 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|