C11H10F7N — CID 154294288
4-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylaniline (PubChem CID 154294288) has the molecular formula C11H10F7N and a molecular weight of 289.19 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylaniline.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylaniline |
|---|---|
| PubChem CID | 154294288 |
| Molecular Formula | C11H10F7N |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylaniline |
| SMILES | CNc1ccc(CC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F7N/c1-19-8-4-2-7(3-5-8)6-9(12,13)10(14,15)11(16,17)18/h2-5,19H,6H2,1H3 |
| InChIKey | YDCMIGDSLVMHFU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|