C12H9F7O — CID 87974106
1-(4-ethenylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-ol (PubChem CID 87974106) has the molecular formula C12H9F7O and a molecular weight of 302.19 g/mol. Its IUPAC name is 1-(4-ethenylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-ol.
| Compound Name | 1-(4-ethenylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
|---|---|
| PubChem CID | 87974106 |
| Molecular Formula | C12H9F7O |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(4-ethenylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
| SMILES | C=Cc1ccc(C(O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F7O/c1-2-7-3-5-8(6-4-7)9(20)10(13,14)11(15,16)12(17,18)19/h2-6,9,20H,1H2 |
| InChIKey | CIIRCHWJNYYINH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|