C10H9BrF2O — CID 15807454
1-(4-bromophenyl)-2,2-difluorobut-3-en-1-ol (PubChem CID 15807454) has the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,2-difluorobut-3-en-1-ol.
| Compound Name | 1-(4-bromophenyl)-2,2-difluorobut-3-en-1-ol |
|---|---|
| PubChem CID | 15807454 |
| Molecular Formula | C10H9BrF2O |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1-(4-bromophenyl)-2,2-difluorobut-3-en-1-ol |
| SMILES | C=CC(F)(F)C(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H9BrF2O/c1-2-10(12,13)9(14)7-3-5-8(11)6-4-7/h2-6,9,14H,1H2 |
| InChIKey | CSRGFRGPUSJYEB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|