C15H18BrF2NO2 — CID 25178274
tert-butyl N-[1-(4-bromophenyl)-2,2-difluorobut-3-enyl]carbamate (PubChem CID 25178274) has the molecular formula C15H18BrF2NO2 and a molecular weight of 362.21 g/mol. Its IUPAC name is tert-butyl N-[1-(4-bromophenyl)-2,2-difluorobut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-bromophenyl)-2,2-difluorobut-3-enyl]carbamate |
|---|---|
| PubChem CID | 25178274 |
| Molecular Formula | C15H18BrF2NO2 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | tert-butyl N-[1-(4-bromophenyl)-2,2-difluorobut-3-enyl]carbamate |
| SMILES | C=CC(F)(F)C(NC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrF2NO2/c1-5-15(17,18)12(10-6-8-11(16)9-7-10)19-13(20)21-14(2,3)4/h5-9,12H,1H2,2-4H3,(H,19,20) |
| InChIKey | CXXDXHOPWBWJNU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|