C15H20BrNO3 — CID 139123161
tert-butyl N-[(S)-(4-bromophenyl)-[(Z)-prop-1-enoxy]methyl]carbamate (PubChem CID 139123161) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is tert-butyl N-[(S)-(4-bromophenyl)-[(Z)-prop-1-enoxy]methyl]carbamate.
| Compound Name | tert-butyl N-[(S)-(4-bromophenyl)-[(Z)-prop-1-enoxy]methyl]carbamate |
|---|---|
| PubChem CID | 139123161 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | tert-butyl N-[(S)-(4-bromophenyl)-[(Z)-prop-1-enoxy]methyl]carbamate |
| SMILES | C/C=C\O[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H20BrNO3/c1-5-10-19-13(11-6-8-12(16)9-7-11)17-14(18)20-15(2,3)4/h5-10,13H,1-4H3,(H,17,18)/b10-5-/t13-/m0/s1 |
| InChIKey | WMSGWPMHESDYBD-PRFOUVDFSA-N |
| XLogP | 4.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|