C17H21BrClNO5 — CID 134835900
methyl (2S)-2-[(R)-(4-bromophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-chloro-3-oxobutanoate (PubChem CID 134835900) has the molecular formula C17H21BrClNO5 and a molecular weight of 434.71 g/mol. Its IUPAC name is methyl (2S)-2-[(R)-(4-bromophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-chloro-3-oxobutanoate.
| Compound Name | methyl (2S)-2-[(R)-(4-bromophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-chloro-3-oxobutanoate |
|---|---|
| PubChem CID | 134835900 |
| Molecular Formula | C17H21BrClNO5 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | methyl (2S)-2-[(R)-(4-bromophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-chloro-3-oxobutanoate |
| SMILES | COC(=O)[C@@](Cl)(C(C)=O)[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrClNO5/c1-10(21)17(19,14(22)24-5)13(11-6-8-12(18)9-7-11)20-15(23)25-16(2,3)4/h6-9,13H,1-5H3,(H,20,23)/t13-,17-/m1/s1 |
| InChIKey | QTWLXZPGSNCBFK-CXAGYDPISA-N |
| XLogP | 3.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|