C18H9F15O — CID 150329272
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-naphthalen-2-yloctan-1-ol (PubChem CID 150329272) has the molecular formula C18H9F15O and a molecular weight of 526.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-naphthalen-2-yloctan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-naphthalen-2-yloctan-1-ol |
|---|---|
| PubChem CID | 150329272 |
| Molecular Formula | C18H9F15O |
| Molecular Weight | 526.24 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-naphthalen-2-yloctan-1-ol |
| SMILES | OC(c1ccc2ccccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H9F15O/c19-12(20,11(34)10-6-5-8-3-1-2-4-9(8)7-10)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)33/h1-7,11,34H |
| InChIKey | GPHOMCZRCGOYNC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.24 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|