C19H14F2O2 — CID 134948100
(3R)-2,2-difluoro-3-hydroxy-3-naphthalen-2-yl-1-phenylpropan-1-one (PubChem CID 134948100) has the molecular formula C19H14F2O2 and a molecular weight of 312.32 g/mol. Its IUPAC name is (3R)-2,2-difluoro-3-hydroxy-3-naphthalen-2-yl-1-phenylpropan-1-one.
| Compound Name | (3R)-2,2-difluoro-3-hydroxy-3-naphthalen-2-yl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 134948100 |
| Molecular Formula | C19H14F2O2 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (3R)-2,2-difluoro-3-hydroxy-3-naphthalen-2-yl-1-phenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)[C@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H14F2O2/c20-19(21,17(22)14-7-2-1-3-8-14)18(23)16-11-10-13-6-4-5-9-15(13)12-16/h1-12,18,23H/t18-/m1/s1 |
| InChIKey | QDALVAGBKTUCQW-GOSISDBHSA-N |
| XLogP | 4.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |