C23H16F2O2 — CID 139124035
(3R)-3-anthracen-9-yl-2,2-difluoro-3-hydroxy-1-phenylpropan-1-one (PubChem CID 139124035) has the molecular formula C23H16F2O2 and a molecular weight of 362.38 g/mol. Its IUPAC name is (3R)-3-anthracen-9-yl-2,2-difluoro-3-hydroxy-1-phenylpropan-1-one.
| Compound Name | (3R)-3-anthracen-9-yl-2,2-difluoro-3-hydroxy-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 139124035 |
| Molecular Formula | C23H16F2O2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (3R)-3-anthracen-9-yl-2,2-difluoro-3-hydroxy-1-phenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)[C@H](O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H16F2O2/c24-23(25,21(26)15-8-2-1-3-9-15)22(27)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14,22,27H/t22-/m1/s1 |
| InChIKey | VIMOYKQCJKUTCS-JOCHJYFZSA-N |
| XLogP | 5.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|