C18H14F2O2 — CID 175399771
4-anthracen-9-yl-2,2-difluorobutanoic acid (PubChem CID 175399771) has the molecular formula C18H14F2O2 and a molecular weight of 300.30 g/mol. Its IUPAC name is 4-anthracen-9-yl-2,2-difluorobutanoic acid.
| Compound Name | 4-anthracen-9-yl-2,2-difluorobutanoic acid |
|---|---|
| PubChem CID | 175399771 |
| Molecular Formula | C18H14F2O2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-anthracen-9-yl-2,2-difluorobutanoic acid |
| SMILES | O=C(O)C(F)(F)CCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C18H14F2O2/c19-18(20,17(21)22)10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16/h1-8,11H,9-10H2,(H,21,22) |
| InChIKey | JIUSEUVAZGKXMB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|