C25H30F3NO2 — CID 118513319
(1-octylanthracen-9-yl)methanamine;2,2,2-trifluoroacetic acid (PubChem CID 118513319) has the molecular formula C25H30F3NO2 and a molecular weight of 433.51 g/mol. Its IUPAC name is (1-octylanthracen-9-yl)methanamine;2,2,2-trifluoroacetic acid.
| Compound Name | (1-octylanthracen-9-yl)methanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118513319 |
| Molecular Formula | C25H30F3NO2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (1-octylanthracen-9-yl)methanamine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCc1cccc2cc3ccccc3c(CN)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H29N.C2HF3O2/c1-2-3-4-5-6-7-11-18-13-10-14-20-16-19-12-8-9-15-21(19)22(17-24)23(18)20;3-2(4,5)1(6)7/h8-10,12-16H,2-7,11,17,24H2,1H3;(H,6,7) |
| InChIKey | XGVMCBWCQMDWNF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|