C29H44F3N3O3 — CID 90238869
(5S)-1,5-diamino-16-[1-(aminomethyl)naphthalen-2-yl]hexadecan-6-one;2,2,2-trifluoroacetic acid (PubChem CID 90238869) has the molecular formula C29H44F3N3O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is (5S)-1,5-diamino-16-[1-(aminomethyl)naphthalen-2-yl]hexadecan-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5S)-1,5-diamino-16-[1-(aminomethyl)naphthalen-2-yl]hexadecan-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90238869 |
| Molecular Formula | C29H44F3N3O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | (5S)-1,5-diamino-16-[1-(aminomethyl)naphthalen-2-yl]hexadecan-6-one;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC[C@H](N)C(=O)CCCCCCCCCCc1ccc2ccccc2c1CN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H43N3O.C2HF3O2/c28-20-12-11-16-26(30)27(31)17-8-6-4-2-1-3-5-7-13-23-19-18-22-14-9-10-15-24(22)25(23)21-29;3-2(4,5)1(6)7/h9-10,14-15,18-19,26H,1-8,11-13,16-17,20-21,28-30H2;(H,6,7)/t26-;/m0./s1 |
| InChIKey | GUFXESFVKQWPTI-SNYZSRNZSA-N |
| XLogP | 6.01 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|