C21H29F6N3O7 — CID 23630520
(3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 23630520) has the molecular formula C21H29F6N3O7 and a molecular weight of 549.47 g/mol. Its IUPAC name is (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 23630520 |
| Molecular Formula | C21H29F6N3O7 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | (3S)-3-[[(3S)-3,7-diaminoheptanoyl]amino]-4-phenylbutanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCCCC[C@H](N)CC(=O)N[C@H](CC(=O)O)Cc1ccccc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O3.2C2HF3O2/c18-9-5-4-8-14(19)11-16(21)20-15(12-17(22)23)10-13-6-2-1-3-7-13;2*3-2(4,5)1(6)7/h1-3,6-7,14-15H,4-5,8-12,18-19H2,(H,20,21)(H,22,23);2*(H,6,7)/t14-,15-;;/m0../s1 |
| InChIKey | WICZOZVIZFATSC-WVFPUEBHSA-N |
| XLogP | 2.30 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|