C18H27NO3 — CID 67920843
3-(octanoylamino)-4-phenylbutanoic acid (PubChem CID 67920843) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-(octanoylamino)-4-phenylbutanoic acid.
| Compound Name | 3-(octanoylamino)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 67920843 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-(octanoylamino)-4-phenylbutanoic acid |
| SMILES | CCCCCCCC(=O)NC(CC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-2-3-4-5-9-12-17(20)19-16(14-18(21)22)13-15-10-7-6-8-11-15/h6-8,10-11,16H,2-5,9,12-14H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | RFLWOHWRJORJLQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|