C19H17ClF3NO3 — CID 67361324
(3S)-4-(4-chlorophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]butanoic acid (PubChem CID 67361324) has the molecular formula C19H17ClF3NO3 and a molecular weight of 399.80 g/mol. Its IUPAC name is (3S)-4-(4-chlorophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]butanoic acid.
| Compound Name | (3S)-4-(4-chlorophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67361324 |
| Molecular Formula | C19H17ClF3NO3 |
| Molecular Weight | 399.80 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (3S)-4-(4-chlorophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]acetyl]amino]butanoic acid |
| SMILES | O=C(O)C[C@H](Cc1ccc(Cl)cc1)NC(=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H17ClF3NO3/c20-14-7-5-12(6-8-14)9-15(11-18(26)27)24-17(25)10-13-3-1-2-4-16(13)19(21,22)23/h1-8,15H,9-11H2,(H,24,25)(H,26,27)/t15-/m0/s1 |
| InChIKey | GOKBFKLAGSSQBE-HNNXBMFYSA-N |
| XLogP | 4.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |