C17H28N2O2 — CID 107863107
3-amino-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-5,5-dimethylhexanamide (PubChem CID 107863107) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-amino-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-5,5-dimethylhexanamide.
| Compound Name | 3-amino-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 107863107 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-amino-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C17H28N2O2/c1-17(2,3)11-14(18)10-16(21)19-15(12-20)9-13-7-5-4-6-8-13/h4-8,14-15,20H,9-12,18H2,1-3H3,(H,19,21)/t14?,15-/m0/s1 |
| InChIKey | RSOOHLZHDKQXPT-LOACHALJSA-N |
| XLogP | 1.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |