C17H27NO2 — CID 107861443
N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4,4-trimethylpentanamide (PubChem CID 107861443) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4,4-trimethylpentanamide.
| Compound Name | N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107861443 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)N[C@@H](CO)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H27NO2/c1-13(17(2,3)4)10-16(20)18-15(12-19)11-14-8-6-5-7-9-14/h5-9,13,15,19H,10-12H2,1-4H3,(H,18,20)/t13?,15-/m1/s1 |
| InChIKey | ZSBDKAFSUBHNQP-AWKYBWMHSA-N |
| XLogP | 2.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |