C14H18F2O2 — CID 86073360
2,2-difluoro-3-hydroxy-1-phenyloctan-1-one (PubChem CID 86073360) has the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-1-phenyloctan-1-one.
| Compound Name | 2,2-difluoro-3-hydroxy-1-phenyloctan-1-one |
|---|---|
| PubChem CID | 86073360 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-1-phenyloctan-1-one |
| SMILES | CCCCCC(O)C(F)(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18F2O2/c1-2-3-5-10-12(17)14(15,16)13(18)11-8-6-4-7-9-11/h4,6-9,12,17H,2-3,5,10H2,1H3 |
| InChIKey | HGYJZWJXESUXGW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|