C12H9ClF8 — CID 15485608
(6-chloro-3,3,4,4,5,5,6,6-octafluorohexyl)benzene (PubChem CID 15485608) has the molecular formula C12H9ClF8 and a molecular weight of 340.64 g/mol. Its IUPAC name is (6-chloro-3,3,4,4,5,5,6,6-octafluorohexyl)benzene.
| Compound Name | (6-chloro-3,3,4,4,5,5,6,6-octafluorohexyl)benzene |
|---|---|
| PubChem CID | 15485608 |
| Molecular Formula | C12H9ClF8 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (6-chloro-3,3,4,4,5,5,6,6-octafluorohexyl)benzene |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)CCc1ccccc1 |
| InChI | InChI=1S/C12H9ClF8/c13-12(20,21)11(18,19)10(16,17)9(14,15)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | XPMGZBLNFBUSQF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|