C25H26F16S — CID 59817062
2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-17-phenylheptadecyl)thiirane (PubChem CID 59817062) has the molecular formula C25H26F16S and a molecular weight of 662.52 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-17-phenylheptadecyl)thiirane.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-17-phenylheptadecyl)thiirane |
|---|---|
| PubChem CID | 59817062 |
| Molecular Formula | C25H26F16S |
| Molecular Weight | 662.52 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-17-phenylheptadecyl)thiirane |
| SMILES | FC(F)(CCCCCCCCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1CS1 |
| InChI | InChI=1S/C25H26F16S/c26-18(27,13-9-4-2-1-3-6-10-16-11-7-5-8-12-16)20(30,31)22(34,35)24(38,39)25(40,41)23(36,37)21(32,33)19(28,29)14-17-15-42-17/h5,7-8,11-12,17H,1-4,6,9-10,13-15H2 |
| InChIKey | VUVGZVWOUSWPPD-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.52 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|