C18H17F5 — CID 132538452
1-(1,1-difluoro-5-phenylpentyl)-4-(trifluoromethyl)benzene (PubChem CID 132538452) has the molecular formula C18H17F5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 1-(1,1-difluoro-5-phenylpentyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1,1-difluoro-5-phenylpentyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 132538452 |
| Molecular Formula | C18H17F5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(1,1-difluoro-5-phenylpentyl)-4-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(C(F)(F)CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H17F5/c19-17(20,13-5-4-8-14-6-2-1-3-7-14)15-9-11-16(12-10-15)18(21,22)23/h1-3,6-7,9-12H,4-5,8,13H2 |
| InChIKey | FQRAQQIILBNOON-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|