C15H13F9O — CID 19068384
1-ethenyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)benzene (PubChem CID 19068384) has the molecular formula C15H13F9O and a molecular weight of 380.25 g/mol. Its IUPAC name is 1-ethenyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)benzene.
| Compound Name | 1-ethenyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)benzene |
|---|---|
| PubChem CID | 19068384 |
| Molecular Formula | C15H13F9O |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-ethenyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)benzene |
| SMILES | C=Cc1ccccc1COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F9O/c1-2-10-5-3-4-6-11(10)9-25-8-7-12(16,17)13(18,19)14(20,21)15(22,23)24/h2-6H,1,7-9H2 |
| InChIKey | ROBIXJOHHPYXJY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|