About diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene
diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene (PubChem CID 155410211) has the molecular formula C30H29OP
and a molecular weight of 436.54 g/mol. Its IUPAC name is diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene.
Molecular Properties
| Compound Name | diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene |
| PubChem CID | 155410211 |
| Molecular Formula | C30H29OP |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene |
| SMILES | C=Cc1ccccc1COCc1ccccc1C=C.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O.C12H11P/c1-3-15-9-5-7-11-17(15)13-19-14-18-12-8-6-10-16(18)4-2;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-12H,1-2,13-14H2;1-10,13H |
| InChIKey | WTCQLRGZAMZFSI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene?
The IUPAC name of diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene (CID 155410211) is diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene.
What is the SMILES notation for diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene?
The canonical SMILES for diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene is C=Cc1ccccc1COCc1ccccc1C=C.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene?
The InChIKey is WTCQLRGZAMZFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O.C12H11P/c1-3-15-9-5-7-11-17(15)13-19-14-18-12-8-6-10-16(18)4-2;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-12H,1-2,13-14H2;1-10,13H.
What are the key properties of diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene?
diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene has a molecular weight of 436.54 g/mol, XLogP of 7.01, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;1-ethenyl-2-[(2-ethenylphenyl)methoxymethyl]benzene is sourced from PubChem (CID 155410211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).