About ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane
ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane (PubChem CID 145463333) has the molecular formula C14H21F3
and a molecular weight of 246.32 g/mol. Its IUPAC name is ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane |
| PubChem CID | 145463333 |
| Molecular Formula | C14H21F3 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane |
| SMILES | C=Cc1ccccc1CC.CC.CC(F)(F)F |
| InChI | InChI=1S/C10H12.C2H3F3.C2H6/c1-3-9-7-5-6-8-10(9)4-2;1-2(3,4)5;1-2/h3,5-8H,1,4H2,2H3;1H3;1-2H3 |
| InChIKey | IPYXNOIYCUBPFU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane?
The IUPAC name of ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane (CID 145463333) is ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane.
What is the SMILES notation for ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane?
The canonical SMILES for ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane is C=Cc1ccccc1CC.CC.CC(F)(F)F.
What is the InChIKey of ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane?
The InChIKey is IPYXNOIYCUBPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C2H3F3.C2H6/c1-3-9-7-5-6-8-10(9)4-2;1-2(3,4)5;1-2/h3,5-8H,1,4H2,2H3;1H3;1-2H3.
What are the key properties of ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane?
ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane has a molecular weight of 246.32 g/mol, XLogP of 5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-2-ethylbenzene;1,1,1-trifluoroethane is sourced from PubChem (CID 145463333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).