C12H10F6 — CID 19364561
1-ethenyl-2-(2,2,3,3,4,4-hexafluorobutyl)benzene (PubChem CID 19364561) has the molecular formula C12H10F6 and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-ethenyl-2-(2,2,3,3,4,4-hexafluorobutyl)benzene.
| Compound Name | 1-ethenyl-2-(2,2,3,3,4,4-hexafluorobutyl)benzene |
|---|---|
| PubChem CID | 19364561 |
| Molecular Formula | C12H10F6 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-ethenyl-2-(2,2,3,3,4,4-hexafluorobutyl)benzene |
| SMILES | C=Cc1ccccc1CC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H10F6/c1-2-8-5-3-4-6-9(8)7-11(15,16)12(17,18)10(13)14/h2-6,10H,1,7H2 |
| InChIKey | HWMIMUXNYVNEOH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|