About 1-ethenyl-2-ethylbenzene;4-ethenylpyridine
1-ethenyl-2-ethylbenzene;4-ethenylpyridine (PubChem CID 175575615) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-ethenyl-2-ethylbenzene;4-ethenylpyridine.
Molecular Properties
| Compound Name | 1-ethenyl-2-ethylbenzene;4-ethenylpyridine |
| PubChem CID | 175575615 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-ethenyl-2-ethylbenzene;4-ethenylpyridine |
| SMILES | C=Cc1ccccc1CC.C=Cc1ccncc1 |
| InChI | InChI=1S/C10H12.C7H7N/c1-3-9-7-5-6-8-10(9)4-2;1-2-7-3-5-8-6-4-7/h3,5-8H,1,4H2,2H3;2-6H,1H2 |
| InChIKey | KRXHDAMPQXAXFP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-2-ethylbenzene;4-ethenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-ethylbenzene;4-ethenylpyridine?
The IUPAC name of 1-ethenyl-2-ethylbenzene;4-ethenylpyridine (CID 175575615) is 1-ethenyl-2-ethylbenzene;4-ethenylpyridine.
What is the SMILES notation for 1-ethenyl-2-ethylbenzene;4-ethenylpyridine?
The canonical SMILES for 1-ethenyl-2-ethylbenzene;4-ethenylpyridine is C=Cc1ccccc1CC.C=Cc1ccncc1.
What is the InChIKey of 1-ethenyl-2-ethylbenzene;4-ethenylpyridine?
The InChIKey is KRXHDAMPQXAXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C7H7N/c1-3-9-7-5-6-8-10(9)4-2;1-2-7-3-5-8-6-4-7/h3,5-8H,1,4H2,2H3;2-6H,1H2.
What are the key properties of 1-ethenyl-2-ethylbenzene;4-ethenylpyridine?
1-ethenyl-2-ethylbenzene;4-ethenylpyridine has a molecular weight of 237.35 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-ethylbenzene;4-ethenylpyridine is sourced from PubChem (CID 175575615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).