C24H32 — CID 158873338
1-butyl-2-ethenylbenzene;1-butyl-4-ethenylbenzene (PubChem CID 158873338) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-butyl-2-ethenylbenzene;1-butyl-4-ethenylbenzene.
| Compound Name | 1-butyl-2-ethenylbenzene;1-butyl-4-ethenylbenzene |
|---|---|
| PubChem CID | 158873338 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-butyl-2-ethenylbenzene;1-butyl-4-ethenylbenzene |
| SMILES | C=Cc1ccc(CCCC)cc1.C=Cc1ccccc1CCCC |
| InChI | InChI=1S/2C12H16/c1-3-5-8-12-10-7-6-9-11(12)4-2;1-3-5-6-12-9-7-11(4-2)8-10-12/h4,6-7,9-10H,2-3,5,8H2,1H3;4,7-10H,2-3,5-6H2,1H3 |
| InChIKey | JCCSWGUEWXUKDQ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |