C16H24 — CID 140596757
1,4-dibutyl-2-ethenylbenzene (PubChem CID 140596757) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1,4-dibutyl-2-ethenylbenzene.
| Compound Name | 1,4-dibutyl-2-ethenylbenzene |
|---|---|
| PubChem CID | 140596757 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1,4-dibutyl-2-ethenylbenzene |
| SMILES | C=Cc1cc(CCCC)ccc1CCCC |
| InChI | InChI=1S/C16H24/c1-4-7-9-14-11-12-16(10-8-5-2)15(6-3)13-14/h6,11-13H,3-5,7-10H2,1-2H3 |
| InChIKey | ZUDXJJSIPRDRFL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |