About 1-ethenyl-2,4-dipropylbenzene
1-ethenyl-2,4-dipropylbenzene (PubChem CID 22033822) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-ethenyl-2,4-dipropylbenzene.
Molecular Properties
| Compound Name | 1-ethenyl-2,4-dipropylbenzene |
| PubChem CID | 22033822 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-ethenyl-2,4-dipropylbenzene |
| SMILES | C=Cc1ccc(CCC)cc1CCC |
| InChI | InChI=1S/C14H20/c1-4-7-12-9-10-13(6-3)14(11-12)8-5-2/h6,9-11H,3-5,7-8H2,1-2H3 |
| InChIKey | CCYFATPNAXTAFW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-2,4-dipropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,4-dipropylbenzene?
The IUPAC name of 1-ethenyl-2,4-dipropylbenzene (CID 22033822) is 1-ethenyl-2,4-dipropylbenzene.
What is the SMILES notation for 1-ethenyl-2,4-dipropylbenzene?
The canonical SMILES for 1-ethenyl-2,4-dipropylbenzene is C=Cc1ccc(CCC)cc1CCC.
What is the InChIKey of 1-ethenyl-2,4-dipropylbenzene?
The InChIKey is CCYFATPNAXTAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-4-7-12-9-10-13(6-3)14(11-12)8-5-2/h6,9-11H,3-5,7-8H2,1-2H3.
What are the key properties of 1-ethenyl-2,4-dipropylbenzene?
1-ethenyl-2,4-dipropylbenzene has a molecular weight of 188.31 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,4-dipropylbenzene is sourced from PubChem (CID 22033822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).