C17H26 — CID 151469521
2-pent-1-enyl-1,4-dipropylbenzene (PubChem CID 151469521) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 2-pent-1-enyl-1,4-dipropylbenzene.
| Compound Name | 2-pent-1-enyl-1,4-dipropylbenzene |
|---|---|
| PubChem CID | 151469521 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-pent-1-enyl-1,4-dipropylbenzene |
| SMILES | CCCC=Cc1cc(CCC)ccc1CCC |
| InChI | InChI=1S/C17H26/c1-4-7-8-11-17-14-15(9-5-2)12-13-16(17)10-6-3/h8,11-14H,4-7,9-10H2,1-3H3 |
| InChIKey | PKEAJOSHMANAAE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |